7-[3-(dibenzylamino)-2-hydroxypropyl]-1,3-dimethylpurine-2,6-dione
Modify Date: 2025-10-23 17:23:45
![7-[3-(dibenzylamino)-2-hydroxypropyl]-1,3-dimethylpurine-2,6-dione Structure](https://image.chemsrc.com/caspic/108/5096-28-6.png)
7-[3-(dibenzylamino)-2-hydroxypropyl]-1,3-dimethylpurine-2,6-dione structure
|
Common Name | 7-[3-(dibenzylamino)-2-hydroxypropyl]-1,3-dimethylpurine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 5096-28-6 | Molecular Weight | 433.50300 | |
| Density | 1.26g/cm3 | Boiling Point | 657.5ºC at 760 mmHg | |
| Molecular Formula | C24H27N5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 351.5ºC | |
| Name | 7-[3-(dibenzylamino)-2-hydroxypropyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 657.5ºC at 760 mmHg |
| Molecular Formula | C24H27N5O3 |
| Molecular Weight | 433.50300 |
| Flash Point | 351.5ºC |
| Exact Mass | 433.21100 |
| PSA | 85.29000 |
| LogP | 1.49700 |
| Index of Refraction | 1.643 |
| InChIKey | FBFMWXKTHIEXGH-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)c2c(ncn2CC(O)CN(Cc2ccccc2)Cc2ccccc2)n(C)c1=O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-<2-Hydroxy-3-dibenzylamino-propyl>-theophyllin |