7-[3-(diethylamino)-2-hydroxypropyl]-1,3-dimethylpurine-2,6-dione
Modify Date: 2025-09-18 13:02:23
![7-[3-(diethylamino)-2-hydroxypropyl]-1,3-dimethylpurine-2,6-dione Structure](https://image.chemsrc.com/caspic/222/5096-25-3.png)
7-[3-(diethylamino)-2-hydroxypropyl]-1,3-dimethylpurine-2,6-dione structure
|
Common Name | 7-[3-(diethylamino)-2-hydroxypropyl]-1,3-dimethylpurine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 5096-25-3 | Molecular Weight | 309.36400 | |
| Density | 1.3g/cm3 | Boiling Point | 534.2ºC at 760 mmHg | |
| Molecular Formula | C14H23N5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 276.9ºC | |
| Name | 7-[3-(diethylamino)-2-hydroxypropyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 534.2ºC at 760 mmHg |
| Molecular Formula | C14H23N5O3 |
| Molecular Weight | 309.36400 |
| Flash Point | 276.9ºC |
| Exact Mass | 309.18000 |
| PSA | 85.29000 |
| Index of Refraction | 1.613 |
| InChIKey | MDBUFZGCCAQYOS-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC(O)Cn1cnc2c1c(=O)n(C)c(=O)n2C |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-<2-Hydroxy-3-diaethylamino-propyl>-theophyllin |