19-O-Acetylchaetoglobosin A structure
|
Common Name | 19-O-Acetylchaetoglobosin A | ||
|---|---|---|---|---|
| CAS Number | 50939-69-0 | Molecular Weight | 570.68 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C34H38N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 19-O-Acetylchaetoglobosin A19-O-Acetylchaetoglobosin A, a cytochalasan alkaloid, is a fungal metabolite originally isolated from C. globosum that has actin polymerization inhibitory and cytotoxic activities. 19-O-Acetylchaetoglobosin A is cytotoxic to HeLa cervical cancer cells[1]. |
| Name | 19-O-Acetylchaetoglobosin A |
|---|
| Description | 19-O-Acetylchaetoglobosin A, a cytochalasan alkaloid, is a fungal metabolite originally isolated from C. globosum that has actin polymerization inhibitory and cytotoxic activities. 19-O-Acetylchaetoglobosin A is cytotoxic to HeLa cervical cancer cells[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C34H38N2O6 |
|---|---|
| Molecular Weight | 570.68 |
| InChIKey | AZLAYOMQTNEYFJ-RSWMAEPRSA-N |
| SMILES | CC(=O)OC1C(=O)C=CC(=O)C23C(=O)NC(Cc4c[nH]c5ccccc45)C2C(C)C2(C)OC2C3C=CCC(C)C=C1C |
| Storage condition | -20°C |