(3-FLUOROPHENYL)[2-NITRO-4-[(PIPERIDIN-1-YL)METHYL]PHENYL]AMINE
Modify Date: 2025-08-25 19:06:25
![(3-FLUOROPHENYL)[2-NITRO-4-[(PIPERIDIN-1-YL)METHYL]PHENYL]AMINE Structure](https://image.chemsrc.com/caspic/344/509093-96-3.png)
(3-FLUOROPHENYL)[2-NITRO-4-[(PIPERIDIN-1-YL)METHYL]PHENYL]AMINE structure
|
Common Name | (3-FLUOROPHENYL)[2-NITRO-4-[(PIPERIDIN-1-YL)METHYL]PHENYL]AMINE | ||
|---|---|---|---|---|
| CAS Number | 509093-96-3 | Molecular Weight | 329.36900 | |
| Density | 1.277g/cm3 | Boiling Point | 445.2ºC at 760 mmHg | |
| Molecular Formula | C18H20FN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223ºC | |
| Name | N-(3-fluorophenyl)-2-nitro-4-(piperidin-1-ylmethyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.277g/cm3 |
|---|---|
| Boiling Point | 445.2ºC at 760 mmHg |
| Molecular Formula | C18H20FN3O2 |
| Molecular Weight | 329.36900 |
| Flash Point | 223ºC |
| Exact Mass | 329.15400 |
| PSA | 61.09000 |
| LogP | 4.99750 |
| Index of Refraction | 1.629 |
| InChIKey | ICXGVQJZJFERDF-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(CN2CCCCC2)ccc1Nc1cccc(F)c1 |
| HS Code | 2933399090 |
|---|
|
~%
(3-FLUOROPHENYL... CAS#:509093-96-3 |
| Literature: Tularik, Inc Patent: US2003/144286 A1, 2003 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| i01-9394 |