Ethanone,1-[2-[2-(5-nitro-2-thienyl)ethenyl]-1H-imidazol-1-yl]-
Modify Date: 2024-01-09 11:15:51
![Ethanone,1-[2-[2-(5-nitro-2-thienyl)ethenyl]-1H-imidazol-1-yl]- Structure](https://image.chemsrc.com/caspic/217/50832-68-3.png)
Ethanone,1-[2-[2-(5-nitro-2-thienyl)ethenyl]-1H-imidazol-1-yl]- structure
|
Common Name | Ethanone,1-[2-[2-(5-nitro-2-thienyl)ethenyl]-1H-imidazol-1-yl]- | ||
|---|---|---|---|---|
| CAS Number | 50832-68-3 | Molecular Weight | 263.27200 | |
| Density | 1.42g/cm3 | Boiling Point | 498.4ºC at 760 mmHg | |
| Molecular Formula | C11H9N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255.2ºC | |
| Name | 1-[2-[(Z)-2-(5-nitrothiophen-2-yl)ethenyl]imidazol-1-yl]ethanone |
|---|
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 498.4ºC at 760 mmHg |
| Molecular Formula | C11H9N3O3S |
| Molecular Weight | 263.27200 |
| Flash Point | 255.2ºC |
| Exact Mass | 263.03600 |
| PSA | 108.95000 |
| LogP | 3.20650 |
| Index of Refraction | 1.674 |
| InChIKey | BJYIRAKHEVXNEI-DUXPYHPUSA-N |
| SMILES | CC(=O)n1ccnc1C=Cc1ccc([N+](=O)[O-])s1 |
|
~%
Ethanone,1-[2-[... CAS#:50832-68-3 |
| Literature: Henry; Brown; Cory; et al. Journal of Medicinal Chemistry, 1973 , vol. 16, # 11 p. 1287 - 1291 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |