Phosphonothioicdiamide, N,N,N',N'-tetramethyl-P-4-morpholinyl- (9CI) structure
|
Common Name | Phosphonothioicdiamide, N,N,N',N'-tetramethyl-P-4-morpholinyl- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 50822-48-5 | Molecular Weight | 237.30300 | |
| Density | 1.17g/cm3 | Boiling Point | 306.8ºC at 760mmHg | |
| Molecular Formula | C8H20N3OPS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139.3ºC | |
| Name | N-[dimethylamino(morpholin-4-yl)phosphinothioyl]-N-methylmethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 306.8ºC at 760mmHg |
| Molecular Formula | C8H20N3OPS |
| Molecular Weight | 237.30300 |
| Flash Point | 139.3ºC |
| Exact Mass | 237.10600 |
| PSA | 60.85000 |
| LogP | 1.25480 |
| Index of Refraction | 1.546 |
| InChIKey | YNZQUAOYCOCVOP-UHFFFAOYSA-N |
| SMILES | CN(C)P(=S)(N(C)C)N1CCOCC1 |
|
~62%
Phosphonothioic... CAS#:50822-48-5 |
| Literature: Prasmitskene, G. I.; Karpavichyus, K. I.; Knunyants, I. L. Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), 1983 , vol. 32, # 10 p. 2138 - 2140 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, 1983 , # 10 p. 2373 - 2375 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| morpholin-4-yl-phosphonothioic acid bis-dimethylamide |