3-(2,4-dichlorophenyl)-1-(3,4-dichlorophenyl)-4,5-dihydro-2H-pyrrolo[2,3-c]pyrazole structure
|
Common Name | 3-(2,4-dichlorophenyl)-1-(3,4-dichlorophenyl)-4,5-dihydro-2H-pyrrolo[2,3-c]pyrazole | ||
|---|---|---|---|---|
| CAS Number | 5079-44-7 | Molecular Weight | 399.10100 | |
| Density | 1.59g/cm3 | Boiling Point | 552.9ºC at 760 mmHg | |
| Molecular Formula | C17H11Cl4N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 288.2ºC | |
| Name | 3-(2,4-dichlorophenyl)-1-(3,4-dichlorophenyl)-4,5-dihydro-2H-pyrrolo[2,3-c]pyrazole |
|---|
| Density | 1.59g/cm3 |
|---|---|
| Boiling Point | 552.9ºC at 760 mmHg |
| Molecular Formula | C17H11Cl4N3 |
| Molecular Weight | 399.10100 |
| Flash Point | 288.2ºC |
| Exact Mass | 396.97100 |
| PSA | 33.08000 |
| LogP | 4.97840 |
| Index of Refraction | 1.725 |
| InChIKey | JRTFZCDLOREXHV-UHFFFAOYSA-N |
| SMILES | Clc1ccc(-c2nn(-c3ccc(Cl)c(Cl)c3)c3c2CCN3)c(Cl)c1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |