Autocamtide-2-related inhibitory peptide, myristoylated TFA
Modify Date: 2025-08-25 18:14:58
Autocamtide-2-related inhibitory peptide, myristoylated TFA structure
|
Common Name | Autocamtide-2-related inhibitory peptide, myristoylated TFA | ||
|---|---|---|---|---|
| CAS Number | 507471-72-9 | Molecular Weight | 923.81000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C39H50N5O19P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Autocamtide-2-related inhibitory peptide, myristoylated TFACaffeic acid-pYEEIE, a non-phosphopeptide inhibitor, exhibits potent binding affinity for the GST-Lck-SH2 domain[1]. |
| Name | Caffeic acid-pYEEIE,N-[3-(3,4-Dihydroxyphenyl)-1-oxo-2-propenyl]-O-phosphono-L-tyrosyl-L-α-glutamyl-L-α-glutamyl-L-isoleucyl-L-glutamicacid |
|---|---|
| Synonym | More Synonyms |
| Description | Caffeic acid-pYEEIE, a non-phosphopeptide inhibitor, exhibits potent binding affinity for the GST-Lck-SH2 domain[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C39H50N5O19P |
|---|---|
| Molecular Weight | 923.81000 |
| Exact Mass | 923.28400 |
| PSA | 411.73000 |
| LogP | 1.92880 |
| InChIKey | OLKLXQPYJYPETQ-YYGGXQSLSA-N |
| SMILES | CCC(C)C(NC(=O)C(CCC(=O)O)NC(=O)C(CCC(=O)O)NC(=O)C(Cc1ccc(OP(=O)(O)O)cc1)NC(=O)C=Cc1ccc(O)c(O)c1)C(=O)NC(CCC(=O)O)C(=O)O |
| caffeic acid-pyeeie |