2-[[3-(3,4-dimethylphenyl)adamantane-1-carbonyl]amino]benzoic acid structure
|
Common Name | 2-[[3-(3,4-dimethylphenyl)adamantane-1-carbonyl]amino]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 50741-83-8 | Molecular Weight | 403.51300 | |
| Density | 1.273g/cm3 | Boiling Point | 618.9ºC at 760 mmHg | |
| Molecular Formula | C26H29NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 328.1ºC | |
| Name | 2-[[3-(3,4-dimethylphenyl)adamantane-1-carbonyl]amino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.273g/cm3 |
|---|---|
| Boiling Point | 618.9ºC at 760 mmHg |
| Molecular Formula | C26H29NO3 |
| Molecular Weight | 403.51300 |
| Flash Point | 328.1ºC |
| Exact Mass | 403.21500 |
| PSA | 69.89000 |
| LogP | 6.12780 |
| Index of Refraction | 1.658 |
| InChIKey | DTADCQZFUVPRNG-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C23CC4CC(CC(C(=O)Nc5ccccc5C(=O)O)(C4)C2)C3)cc1C |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(5-(3',4'-Xylyl)-3-adamantoyl)anthranilic acid |
| N-(5-(3',4'-Xylyl)-3-adamantylcarbonyl)anthranilic acid |
| Benzoic acid,2-(((3-(3,4-dimethylphenyl)tricyclo(3.3.1.1(sup 3,7))dec-1-yl)carbonyl)amino) |
| Anthranilic acid,N-(5-(3',4'-xylyl)-3-adamantylcarbonyl) |