17-Norkaura-1,15-diene-3,12-dione,2- hydroxy-13-methyl-,(8â,13â)- structure
|
Common Name | 17-Norkaura-1,15-diene-3,12-dione,2- hydroxy-13-methyl-,(8â,13â)- | ||
|---|---|---|---|---|
| CAS Number | 50719-31-8 | Molecular Weight | 314.41900 | |
| Density | 1.19g/cm3 | Boiling Point | 465.1ºC at 760 mmHg | |
| Molecular Formula | C20H26O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.2ºC | |
| Name | ent-2-hydroxybeyera-1,15-diene-3,12-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 465.1ºC at 760 mmHg |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.41900 |
| Flash Point | 249.2ºC |
| Exact Mass | 314.18800 |
| PSA | 54.37000 |
| LogP | 3.99510 |
| Index of Refraction | 1.582 |
| InChIKey | QPTSUMMYEGOBLJ-UHFFFAOYSA-N |
| SMILES | CC12C=CC3(CCC4C(C)(C)C(=O)C(O)=CC4(C)C3CC1=O)C2 |
|
~%
17-Norkaura-1,1... CAS#:50719-31-8 |
| Literature: Piacenza,L.P.L. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1979 , p. 1004 - 1012 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-hydroxybeyera-1,15-diene-3,12-dione |