(4-methyl-2-nitrophenyl)hydrazine structure
|
Common Name | (4-methyl-2-nitrophenyl)hydrazine | ||
|---|---|---|---|---|
| CAS Number | 50707-83-0 | Molecular Weight | 167.16500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H9N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-methyl-2-nitrophenyl)hydrazine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H9N3O2 |
|---|---|
| Molecular Weight | 167.16500 |
| Exact Mass | 167.06900 |
| PSA | 83.87000 |
| LogP | 2.48530 |
| InChIKey | COWMLQSNMSCSOL-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NN)c([N+](=O)[O-])c1 |
|
~%
(4-methyl-2-nit... CAS#:50707-83-0 |
| Literature: Davies Journal of the Chemical Society, 1922 , vol. 121, p. 720 |
|
~%
(4-methyl-2-nit... CAS#:50707-83-0 |
| Literature: Lindley, John M.; McRobbie, Ian M.; Meth-Cohn, Otto; Suschitzky, Hans Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1980 , p. 982 - 994 |
| 4-Methyl-2-nitro-phenylhydrazin |
| 4-methyl-2-nitrophenylhydrazine |
| 3-Nitro-4-hydrazino-toluol |