4-Methyl-3-nitrolaurophenone structure
|
Common Name | 4-Methyl-3-nitrolaurophenone | ||
|---|---|---|---|---|
| CAS Number | 50671-18-6 | Molecular Weight | 319.43800 | |
| Density | 1.016 | Boiling Point | 411ºC | |
| Molecular Formula | C19H29NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164ºC | |
| Name | 4-methyl-3-nitro-1-phenyldodecan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.016 |
|---|---|
| Boiling Point | 411ºC |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.43800 |
| Flash Point | 164ºC |
| Exact Mass | 319.21500 |
| PSA | 62.89000 |
| LogP | 6.53000 |
| Index of Refraction | 1.51 |
| InChIKey | RMUJGJJPZJRQSW-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC(C)C(CC(=O)c1ccccc1)[N+](=O)[O-] |
| HS Code | 2914700090 |
|---|
|
~%
4-Methyl-3-nitr... CAS#:50671-18-6 |
| Literature: Minnes.Min.Man.Co. Patent: DE2263587 , 1973 ; Chem.Abstr., 1974 , vol. 80, # 49278 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1-(4-Methyl-3-nitrophenyl)-1-dodecanone |
| 3-Nitro-4-methyllaurophenon |
| Q989 |
| 1-Dodecanone,1-(4-methyl-3-nitrophenyl) |
| 4-METHYL-3-NITROLAUROPHENONE |