piroctone
Modify Date: 2025-08-23 22:44:32
piroctone structure
|
Common Name | piroctone | ||
|---|---|---|---|---|
| CAS Number | 50650-76-5 | Molecular Weight | 237.33800 | |
| Density | 1.029 | Boiling Point | 344.1ºC at 760 mmHg | |
| Molecular Formula | C14H23NO2 | Melting Point | 108ºC | |
| MSDS | N/A | Flash Point | 161.9ºC | |
| Name | piroctone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.029 |
|---|---|
| Boiling Point | 344.1ºC at 760 mmHg |
| Melting Point | 108ºC |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.33800 |
| Flash Point | 161.9ºC |
| Exact Mass | 237.17300 |
| PSA | 42.23000 |
| LogP | 3.00880 |
| Index of Refraction | 1.512 |
| InChIKey | OIQJEQLSYJSNDS-UHFFFAOYSA-N |
| SMILES | Cc1cc(CC(C)CC(C)(C)C)n(O)c(=O)c1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Piroctonum |
| 1-hydroxy-4-methyl-6-(2,4,4-trimethylpentyl)pyridin-2-one |
| 1-hydroxy-4-methyl-6-(2,4,4-trimethylpentyl)-2(1H)-pyridone |
| 6-(2,4,4-trimethylpentyl)-1-hydroxy-4-methyl-2(1H)-pyridone |
| Piroctone (USAN/INN) |
| Piroctona |
| 1-hydroxy-4-methyl-6-(2,4,4-trimethylpentyl)-2(1 H)-pyridinone |
| 1-hydroxy-4-methyl-6-(2,4,4-trimethyl-pentyl)-2-pyridone |
| Piroctone |
| Piroctonum [INN-Latin] |