(4-propylphenyl) 4-methoxybenzoate
Modify Date: 2025-08-26 06:13:47
(4-propylphenyl) 4-methoxybenzoate structure
|
Common Name | (4-propylphenyl) 4-methoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 50649-28-0 | Molecular Weight | 270.32300 | |
| Density | 1.098g/cm3 | Boiling Point | 404.2ºC at 760 mmHg | |
| Molecular Formula | C17H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.1ºC | |
| Name | (4-propylphenyl) 4-methoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.098g/cm3 |
|---|---|
| Boiling Point | 404.2ºC at 760 mmHg |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.32300 |
| Flash Point | 171.1ºC |
| Exact Mass | 270.12600 |
| PSA | 35.53000 |
| LogP | 3.86690 |
| Index of Refraction | 1.552 |
| InChIKey | YQNHZOBOLKKSLP-UHFFFAOYSA-N |
| SMILES | CCCc1ccc(OC(=O)c2ccc(OC)cc2)cc1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzoic acid,4-methoxy-,4-propylphenyl ester |
| 4-Propylphenyl p-anisate |
| 4-Methoxybenzoic acid,4-n-propylphenyl ester |
| EINECS 256-681-1 |