Benzenesulfonothioicacid, 4-methyl-, S-(1-phenyl-1H-tetrazol-5-yl) ester structure
|
Common Name | Benzenesulfonothioicacid, 4-methyl-, S-(1-phenyl-1H-tetrazol-5-yl) ester | ||
|---|---|---|---|---|
| CAS Number | 50623-01-3 | Molecular Weight | 332.40100 | |
| Density | 1.43g/cm3 | Boiling Point | 548.1ºC at 760 mmHg | |
| Molecular Formula | C14H12N4O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 285.3ºC | |
| Name | 5-(4-methylphenyl)sulfonylsulfanyl-1-phenyltetrazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 548.1ºC at 760 mmHg |
| Molecular Formula | C14H12N4O2S2 |
| Molecular Weight | 332.40100 |
| Flash Point | 285.3ºC |
| Exact Mass | 332.04000 |
| PSA | 111.42000 |
| LogP | 3.53250 |
| Index of Refraction | 1.705 |
| InChIKey | HWMPKARRBLRUAN-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)Sc2nnnn2-c2ccccc2)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| S-(1-Phenyl-1H-tetraazol-5-yl) 4-methylbenzenesulfonothioate |
| 1-phenyl-5-(toluene-4-sulfonylsulfanyl)-1H-tetrazole |