N-butyl-2-oxo-2-(2-phenylhydrazinyl)acetamide structure
|
Common Name | N-butyl-2-oxo-2-(2-phenylhydrazinyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 50618-81-0 | Molecular Weight | 235.28200 | |
| Density | 1.157g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H17N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-butyl-2-oxo-2-(2-phenylhydrazinyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.157g/cm3 |
|---|---|
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.28200 |
| Exact Mass | 235.13200 |
| PSA | 70.23000 |
| LogP | 1.90080 |
| Index of Refraction | 1.565 |
| InChIKey | WJWLJELVOIDVPU-UHFFFAOYSA-N |
| SMILES | CCCCNC(=O)C(=O)NNc1ccccc1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| N-Butylaminooxalyl-N'-phenyl-hydrazin |