green carboxylate
Modify Date: 2025-09-20 14:39:47
green carboxylate structure
|
Common Name | green carboxylate | ||
|---|---|---|---|---|
| CAS Number | 50607-64-2 | Molecular Weight | 233.30600 | |
| Density | 0.99 g/cm3 | Boiling Point | 351.6ºC at 760 mmHg | |
| Molecular Formula | C14H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.8ºC | |
| Name | methyl 2-(2-methylpentylideneamino)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.99 g/cm3 |
|---|---|
| Boiling Point | 351.6ºC at 760 mmHg |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.30600 |
| Flash Point | 144.8ºC |
| Exact Mass | 233.14200 |
| PSA | 38.66000 |
| LogP | 3.61170 |
| Index of Refraction | 1.5 |
| InChIKey | DLMYZQZLWRLQNN-UHFFFAOYSA-N |
| SMILES | CCCC(C)C=Nc1ccccc1C(=O)OC |
| HS Code | 2925290090 |
|---|
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Mevantraal |