ethyl 4-chloro-7-methylquinoline-3-carboxylate
Modify Date: 2024-01-09 08:00:40
ethyl 4-chloro-7-methylquinoline-3-carboxylate structure
|
Common Name | ethyl 4-chloro-7-methylquinoline-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 50593-19-6 | Molecular Weight | 249.69300 | |
| Density | 1.252g/cm3 | Boiling Point | 346.4ºC at 760 mmHg | |
| Molecular Formula | C13H12ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.3ºC | |
| Name | ethyl 4-chloro-7-methylquinoline-3-carboxylate |
|---|
| Density | 1.252g/cm3 |
|---|---|
| Boiling Point | 346.4ºC at 760 mmHg |
| Molecular Formula | C13H12ClNO2 |
| Molecular Weight | 249.69300 |
| Flash Point | 163.3ºC |
| Exact Mass | 249.05600 |
| PSA | 39.19000 |
| LogP | 3.37330 |
| Index of Refraction | 1.601 |
| InChIKey | OXNSYUQJYGBUAZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cnc2cc(C)ccc2c1Cl |
|
~%
ethyl 4-chloro-... CAS#:50593-19-6 |
| Literature: Tani; Mushika; Yamaguchi Chemical and Pharmaceutical Bulletin, 1982 , vol. 30, # 10 p. 3517 - 3529 |
|
~%
ethyl 4-chloro-... CAS#:50593-19-6 |
| Literature: Karolak-Wojciechowska, Janina; Lange, Jerzy; Ksiazek, Waldemar; Gniewosz, Malgorzata; Rump, Slawomir Farmaco, 1998 , vol. 53, # 8-9 p. 579 - 585 |
|
~%
ethyl 4-chloro-... CAS#:50593-19-6 |
| Literature: Karolak-Wojciechowska, Janina; Lange, Jerzy; Ksiazek, Waldemar; Gniewosz, Malgorzata; Rump, Slawomir Farmaco, 1998 , vol. 53, # 8-9 p. 579 - 585 |
|
~%
ethyl 4-chloro-... CAS#:50593-19-6 |
| Literature: Karolak-Wojciechowska, Janina; Lange, Jerzy; Ksiazek, Waldemar; Gniewosz, Malgorzata; Rump, Slawomir Farmaco, 1998 , vol. 53, # 8-9 p. 579 - 585 |
![diethyl 2-{[(3-methylphenyl)amino]methylene}propane-1,3-dioate structure](https://image.chemsrc.com/caspic/414/19056-83-8.png)
