2,3-dibromo-7,8-difluorodibenzo-p-dioxin structure
|
Common Name | 2,3-dibromo-7,8-difluorodibenzo-p-dioxin | ||
|---|---|---|---|---|
| CAS Number | 50585-43-8 | Molecular Weight | 377.96400 | |
| Density | 2g/cm3 | Boiling Point | 379.3ºC at 760 mmHg | |
| Molecular Formula | C12H4Br2F2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.3ºC | |
| Name | 2,3-dibromo-7,8-difluorodibenzo-p-dioxin |
|---|---|
| Synonym | More Synonyms |
| Density | 2g/cm3 |
|---|---|
| Boiling Point | 379.3ºC at 760 mmHg |
| Molecular Formula | C12H4Br2F2O2 |
| Molecular Weight | 377.96400 |
| Flash Point | 214.3ºC |
| Exact Mass | 375.85500 |
| PSA | 18.46000 |
| LogP | 5.38780 |
| Index of Refraction | 1.636 |
| InChIKey | OYZFZUIMCOBMIR-UHFFFAOYSA-N |
| SMILES | Fc1cc2c(cc1F)Oc1cc(Br)c(Br)cc1O2 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,3-Dibrom-7,8-difluordibenzo-p-dioxin |
| 2,3-dibromo-7,8-difluorooxanthrene |
| 2,3-dibromo-7,8-difluoro-dibenzo[1,4]dioxine |