Halonamine
Modify Date: 2025-09-27 21:49:56
Halonamine structure
|
Common Name | Halonamine | ||
|---|---|---|---|---|
| CAS Number | 50583-06-7 | Molecular Weight | 279.73700 | |
| Density | 1.222g/cm3 | Boiling Point | 377.4ºC at 760 mmHg | |
| Molecular Formula | C15H15ClFNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182ºC | |
| Name | 2-[(4-Chlorophenyl)(4-fluorophenyl)methoxy]ethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.222g/cm3 |
|---|---|
| Boiling Point | 377.4ºC at 760 mmHg |
| Molecular Formula | C15H15ClFNO |
| Molecular Weight | 279.73700 |
| Flash Point | 182ºC |
| Exact Mass | 279.08300 |
| PSA | 35.25000 |
| LogP | 4.24410 |
| Index of Refraction | 1.569 |
| InChIKey | ZBBVHMNIPBVCRP-UHFFFAOYSA-N |
| SMILES | NCCOC(c1ccc(F)cc1)c1ccc(Cl)cc1 |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-{[bis(2-hydroxyethyl)amino]methyl}-4-methylphenol |
| Phenol,2-[[bis(2-hydroxyethyl)amino]methyl]-4-methyl |