2-chloro-N-(2,6-dimethylphenyl)-N-(1-methoxypropan-2-yl)acetamide
Modify Date: 2024-04-02 14:08:58
2-chloro-N-(2,6-dimethylphenyl)-N-(1-methoxypropan-2-yl)acetamide structure
|
Common Name | 2-chloro-N-(2,6-dimethylphenyl)-N-(1-methoxypropan-2-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 50563-49-0 | Molecular Weight | 269.76700 | |
| Density | 1.118g/cm3 | Boiling Point | 382ºC at 760 mmHg | |
| Molecular Formula | C14H20ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.8ºC | |
| Name | 2-chloro-N-(2,6-dimethylphenyl)-N-(1-methoxypropan-2-yl)acetamide |
|---|
| Density | 1.118g/cm3 |
|---|---|
| Boiling Point | 382ºC at 760 mmHg |
| Molecular Formula | C14H20ClNO2 |
| Molecular Weight | 269.76700 |
| Flash Point | 184.8ºC |
| Exact Mass | 269.11800 |
| PSA | 29.54000 |
| LogP | 2.91010 |
| Index of Refraction | 1.536 |
| InChIKey | KJYQOYQOCGXPLR-UHFFFAOYSA-N |
| SMILES | COCC(C)N(C(=O)CCl)c1c(C)cccc1C |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |