N-(2,3-dibromopropyl)benzenesulfonamide structure
|
Common Name | N-(2,3-dibromopropyl)benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 50487-74-6 | Molecular Weight | 357.06200 | |
| Density | 1.787g/cm3 | Boiling Point | 418.1ºC at 760 mmHg | |
| Molecular Formula | C9H11Br2NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.7ºC | |
| Name | N-(2,3-dibromopropyl)benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.787g/cm3 |
|---|---|
| Boiling Point | 418.1ºC at 760 mmHg |
| Molecular Formula | C9H11Br2NO2S |
| Molecular Weight | 357.06200 |
| Flash Point | 206.7ºC |
| Exact Mass | 354.88800 |
| PSA | 54.55000 |
| LogP | 3.59500 |
| Index of Refraction | 1.602 |
| InChIKey | CVWDPKUSMCJHMB-UHFFFAOYSA-N |
| SMILES | O=S(=O)(NCC(Br)CBr)c1ccccc1 |
|
~%
N-(2,3-dibromop... CAS#:50487-74-6 |
| Literature: Gensler Journal of the American Chemical Society, 1948 , vol. 70, p. 1843,1845 |
|
~%
N-(2,3-dibromop... CAS#:50487-74-6 |
| Literature: Gensler Journal of the American Chemical Society, 1948 , vol. 70, p. 1843,1845 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| N-(2,3-dibromo-propyl)-benzenesulfonamide |
| N-(2,3-Dibrom-propyl)-benzolsulfonamid |