araneosol structure
|
Common Name | araneosol | ||
|---|---|---|---|---|
| CAS Number | 50461-86-4 | Molecular Weight | 374.341 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 644.4±55.0 °C at 760 mmHg | |
| Molecular Formula | C19H18O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.8±25.0 °C | |
| Name | 5,7-dihydroxy-3,6,8-trimethoxy-2-(4-methoxyphenyl)chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 644.4±55.0 °C at 760 mmHg |
| Molecular Formula | C19H18O8 |
| Molecular Weight | 374.341 |
| Flash Point | 233.8±25.0 °C |
| Exact Mass | 374.100159 |
| PSA | 107.59000 |
| LogP | 1.13 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.640 |
| InChIKey | UZIFGCHUAVTVIL-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2oc3c(OC)c(O)c(OC)c(O)c3c(=O)c2OC)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914509090 |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Araneosol |
| 4H-1-Benzopyran-4-one, 5,7-dihydroxy-3,6,8-trimethoxy-2-(4-methoxyphenyl)- |
| 5,7-Dihydroxy-3,4',6,8-tetramethoxyflavone |
| 5,7-Dihydroxy-3,6,8-trimethoxy-2-(4-methoxyphenyl)-4H-chromen-4-one |
| 5,7-dihydroxy-6,7,8,4'-tetramethoxyflavone |
| 5,7-Dihydroxy-3,6,8,4'-tetramethoxyflavon |
| 5,7-dihydroxy-3,6,8,4'-tetramethoxyflavone |