5-[(4-Fluorophenyl)acetyl]-2-hydroxy-3-methylbenzoic acid
Modify Date: 2025-10-27 16:34:06
![5-[(4-Fluorophenyl)acetyl]-2-hydroxy-3-methylbenzoic acid Structure](https://image.chemsrc.com/caspic/279/50439-08-2.png)
5-[(4-Fluorophenyl)acetyl]-2-hydroxy-3-methylbenzoic acid structure
|
Common Name | 5-[(4-Fluorophenyl)acetyl]-2-hydroxy-3-methylbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 50439-08-2 | Molecular Weight | 288.27000 | |
| Density | 1.352g/cm3 | Boiling Point | 512.7ºC at 760 mmHg | |
| Molecular Formula | C16H13FO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.9ºC | |
| Name | 5-[2-(4-fluorophenyl)acetyl]-2-hydroxy-3-methylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.352g/cm3 |
|---|---|
| Boiling Point | 512.7ºC at 760 mmHg |
| Molecular Formula | C16H13FO4 |
| Molecular Weight | 288.27000 |
| Flash Point | 263.9ºC |
| Exact Mass | 288.08000 |
| PSA | 74.60000 |
| LogP | 2.96330 |
| Index of Refraction | 1.615 |
| InChIKey | RWOCMBGJVOHSLJ-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(=O)Cc2ccc(F)cc2)cc(C(=O)O)c1O |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| f 1243 |