N,N-dimethyl-3-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxypropan-1-amine
Modify Date: 2025-09-18 18:40:09
N,N-dimethyl-3-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxypropan-1-amine structure
|
Common Name | N,N-dimethyl-3-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxypropan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 50432-78-5 | Molecular Weight | 256.42700 | |
| Density | 0.92g/cm3 | Boiling Point | 299.4ºC at 760 mmHg | |
| Molecular Formula | C15H32N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 74.6ºC | |
| Name | N,N-dimethyl-3-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxypropan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.92g/cm3 |
|---|---|
| Boiling Point | 299.4ºC at 760 mmHg |
| Molecular Formula | C15H32N2O |
| Molecular Weight | 256.42700 |
| Flash Point | 74.6ºC |
| Exact Mass | 256.25100 |
| PSA | 15.71000 |
| LogP | 2.54400 |
| Index of Refraction | 1.48 |
| InChIKey | GCBWOTFSWXWNDL-UHFFFAOYSA-N |
| SMILES | CN(C)CCCOC1CC(C)(C)N(C)C(C)(C)C1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| dimethyl-[3-(1,2,2,6,6-pentamethyl-piperidin-4-yloxy)-propyl]-amine |
| Pemerida |
| 1-Propanamine,N,N-dimethyl-3-((1,2,2,6,6-pentamethyl-4-piperidinyl)oxy) |
| Pemeride |
| N,N-Dimethyl-3-((1,2,2,6,6-pentamethyl-4-piperidinyl)oxy)-1-propanamine |
| Pemerida [INN-Spanish] |
| Pemerid |
| Pemerid [INN] |
| 4-(3-Dimethylaminopropoxy)-1,2,2,6,6-pentamethylpiperidine |
| Pemeridum [INN-Latin] |
| 4-<3-Dimethylamino-propyloxy>-1.2.2.6.6-pentamethyl-piperidin |
| Pemeride [INN-French] |