Methyl 4-bromo-2-naphthoate
Modify Date: 2025-10-04 17:56:51
Methyl 4-bromo-2-naphthoate structure
|
Common Name | Methyl 4-bromo-2-naphthoate | ||
|---|---|---|---|---|
| CAS Number | 5043-29-8 | Molecular Weight | 265.10300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H9BrO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Methyl 4-bromo-2-naphthoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H9BrO2 |
|---|---|
| Molecular Weight | 265.10300 |
| Exact Mass | 263.97900 |
| PSA | 26.30000 |
| LogP | 3.38890 |
| InChIKey | XJBIPEKBFHLNHO-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(Br)c2ccccc2c1 |
| HS Code | 2916399090 |
|---|
|
~91%
Detail
|
| Literature: ASTRAZENECA AB Patent: WO2004/792 A1, 2003 ; Location in patent: Page 16 ; |
|
~91%
Methyl 4-bromo-... CAS#:5043-29-8 |
| Literature: Ashworth; Bowden; Dembofsky; Levin; Moss; Robinson; Szczur; Virica Organic Process Research and Development, 2003 , vol. 7, # 1 p. 74 - 81 |
|
~95%
Methyl 4-bromo-... CAS#:5043-29-8 |
| Literature: Escudero, Sonia; Perez, Dolores; Guitian, Enrique; Castedo, Luis Tetrahedron Letters, 1997 , vol. 38, # 30 p. 5375 - 5378 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Methyl-4-Bromo-2-Methylbenzoate |
| 4-Brom-2-naphthoesaeure-methylester |
| methyl 4-bromo-o-toluate |
| methyl 2-methyl-4-bromobenzoate |
| Benzoic Acid,4-Bromo-2-Methyl-,Methyl Ester |
| bromonaphthoate |
| 4-bromo-2-methylbenzoic acid methyl ester |
| 4-bromo-2-naphthoic acid,methyl ester |
| methyl 1-bromo-3-naphthoate |
| 2-METHYL-4-BROMO BENZOIC ACID METHYL ESTER |