1,5-diphenylpenta-1,4-diyn-3-yl N-phenylcarbamate
Modify Date: 2025-10-28 20:13:27
1,5-diphenylpenta-1,4-diyn-3-yl N-phenylcarbamate structure
|
Common Name | 1,5-diphenylpenta-1,4-diyn-3-yl N-phenylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 50428-88-1 | Molecular Weight | 351.39700 | |
| Density | 1.23g/cm3 | Boiling Point | 486ºC at 760 mmHg | |
| Molecular Formula | C24H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.7ºC | |
| Name | 1,5-diphenylpenta-1,4-diyn-3-yl N-phenylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 486ºC at 760 mmHg |
| Molecular Formula | C24H17NO2 |
| Molecular Weight | 351.39700 |
| Flash Point | 247.7ºC |
| Exact Mass | 351.12600 |
| PSA | 38.33000 |
| LogP | 4.78010 |
| Index of Refraction | 1.66 |
| InChIKey | FASZZKAGMOWTEJ-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccccc1)OC(C#Cc1ccccc1)C#Cc1ccccc1 |
|
~%
1,5-diphenylpen... CAS#:50428-88-1 |
| Literature: Migliorese,K.G. et al. Journal of Organic Chemistry, 1974 , vol. 39, p. 739 - 747 |
|
~%
1,5-diphenylpen... CAS#:50428-88-1 |
| Literature: Migliorese,K.G. et al. Journal of Organic Chemistry, 1974 , vol. 39, p. 739 - 747 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1,5-diphenylpenta-1,4-diyn-3-yl phenylcarbamate |
| Bis(phenylethinyl)methyl-N-phenylcarbamat |
| 1,5-diphenyl-3-phenylcarbamoyloxy-penta-1,4-diyne |