3-Chloro-2,4-difluoro-6-nitroaniline
Modify Date: 2025-09-13 15:06:03
3-Chloro-2,4-difluoro-6-nitroaniline structure
|
Common Name | 3-Chloro-2,4-difluoro-6-nitroaniline | ||
|---|---|---|---|---|
| CAS Number | 50408-94-1 | Molecular Weight | 208.55000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H3ClF2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-Chloro-2,4-difluoro-6-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H3ClF2N2O2 |
|---|---|
| Molecular Weight | 208.55000 |
| Exact Mass | 207.98500 |
| PSA | 71.84000 |
| LogP | 3.21300 |
| InChIKey | LXZZOYWXUAYAKR-UHFFFAOYSA-N |
| SMILES | Nc1c([N+](=O)[O-])cc(F)c(Cl)c1F |
| HS Code | 2921420090 |
|---|
|
~%
3-Chloro-2,4-di... CAS#:50408-94-1 |
| Literature: Keana; Kher; Sui Xiong Cai; Dinsmore; Glenn; Guastella; Huang; Ilyin; Lu; Mouser; Woodward; Weber Journal of Medicinal Chemistry, 1995 , vol. 38, # 22 p. 4367 - 4379 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:170098-84-7| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3-chloro-2,4-difluoro-6-nitro-aniline |
| 3-Chlor-2,4-difluor-6-nitro-anilin |
| PC2688 |