4-hydroxyethynylestradiol structure
|
Common Name | 4-hydroxyethynylestradiol | ||
|---|---|---|---|---|
| CAS Number | 50394-90-6 | Molecular Weight | 312.40300 | |
| Density | 1.29g/cm3 | Boiling Point | 478.8ºC at 760 mmHg | |
| Molecular Formula | C20H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.4ºC | |
| Name | (8R,9S,13S,14S)-17-ethynyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,4,17-triol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 478.8ºC at 760 mmHg |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.40300 |
| Flash Point | 221.4ºC |
| Exact Mass | 312.17300 |
| PSA | 60.69000 |
| LogP | 3.29070 |
| Index of Refraction | 1.647 |
| InChIKey | SYFHJXSYRPNSOI-DFJNYNKPSA-N |
| SMILES | C#CC1(O)CCC2C3CCc4c(ccc(O)c4O)C3CCC21C |
|
~%
4-hydroxyethyny... CAS#:50394-90-6 |
| Literature: Choudhary, Muhammad I.; Musharraf, Syed G.; Ali, Rahat A.; Atif, Muhammad; Atta-ur-Rahman Zeitschrift fur Naturforschung - Section B Journal of Chemical Sciences, 2004 , vol. 59, # 3 p. 319 - 323 |
|
~%
4-hydroxyethyny... CAS#:50394-90-6 |
| Literature: Stubenrauch,G.; Knuppen,R. Steroids, 1976 , vol. 28, # 5 p. 733 - 741 |
|
~%
4-hydroxyethyny... CAS#:50394-90-6 |
| Literature: Stubenrauch,G.; Knuppen,R. Steroids, 1976 , vol. 28, # 5 p. 733 - 741 |
|
~%
4-hydroxyethyny... CAS#:50394-90-6 |
| Literature: Xie; Chen; Zhao Steroids, 1990 , vol. 55, # 11 p. 488 - 490 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 19-Norpregna-1,3,5(10)-trien-20-yne-3,4,17alpha-triol |
| 17alpha-ethynyl-4-hydroxyestradiol |
| 17|A-Ethynylestra-1,3,5(10)-triene-3,4,17|A-triol |
| 19-Nor-17|A-pregna-1,3,5(10)-trien-20-yne-3,4,17-triol |
| 4-Hydroxyethynylestradiol |
| (17|A)-19-Norpregna-1,3,5(10)-trien-20-yne-3,4,17-triol |