2-amino-2-(2-nitrophenyl)acetic acid
Modify Date: 2025-08-25 17:50:32
2-amino-2-(2-nitrophenyl)acetic acid structure
|
Common Name | 2-amino-2-(2-nitrophenyl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 50381-53-8 | Molecular Weight | 196.16000 | |
| Density | 1.473g/cm3 | Boiling Point | 413.163ºC at 760 mmHg | |
| Molecular Formula | C8H8N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.674ºC | |
| Name | 2-amino-2-(2-nitrophenyl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.473g/cm3 |
|---|---|
| Boiling Point | 413.163ºC at 760 mmHg |
| Molecular Formula | C8H8N2O4 |
| Molecular Weight | 196.16000 |
| Flash Point | 203.674ºC |
| Exact Mass | 196.04800 |
| PSA | 109.14000 |
| LogP | 1.90270 |
| Index of Refraction | 1.631 |
| InChIKey | CEBXNGWSHWJBHX-UHFFFAOYSA-N |
| SMILES | NC(C(=O)O)c1ccccc1[N+](=O)[O-] |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 2-azanyl-2-(2-nitrophenyl)ethanoic acid |
| Benzeneacetic acid,a-amino-2-nitro |
| amino(2-nitrophenyl)acetic acid |