3-bromomethylmenadione
Modify Date: 2025-11-06 06:42:46
3-bromomethylmenadione structure
|
Common Name | 3-bromomethylmenadione | ||
|---|---|---|---|---|
| CAS Number | 50371-29-4 | Molecular Weight | 265.10300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H9BrO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | phenyl-carbonimidic acid ethyl ester chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H9BrO2 |
|---|---|
| Molecular Weight | 265.10300 |
| Exact Mass | 263.97900 |
| PSA | 34.14000 |
| LogP | 2.77700 |
| InChIKey | DRDSRFKIEAPYHY-UHFFFAOYSA-N |
| SMILES | CC1=C(CBr)C(=O)c2ccccc2C1=O |
| HS Code | 2914700090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:2197-57-1| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| N-Phenyl-chlor-formimidsaeureaethylester |
| N-Phenylimino-chlorameisensaeure-aethylester |
| N-Phenyl-chlorformiminoaethylaether |
| Chlorameisensaeure-phenyliminoaethylaether |
| Kohlensaeure-aethylester-chlorid-anil |
| Phenyl-carbimidsaeure-aethylester-chlorid |