Flunamine
Modify Date: 2025-08-25 15:54:55
Flunamine structure
|
Common Name | Flunamine | ||
|---|---|---|---|---|
| CAS Number | 50366-32-0 | Molecular Weight | 263.28300 | |
| Density | 1.191g/cm3 | Boiling Point | 346.7ºC at 760 mmHg | |
| Molecular Formula | C15H15F2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.5ºC | |
| Name | 2-[bis(4-fluorophenyl)methoxy]ethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.191g/cm3 |
|---|---|
| Boiling Point | 346.7ºC at 760 mmHg |
| Molecular Formula | C15H15F2NO |
| Molecular Weight | 263.28300 |
| Flash Point | 163.5ºC |
| Exact Mass | 263.11200 |
| PSA | 35.25000 |
| LogP | 3.72980 |
| Index of Refraction | 1.547 |
| InChIKey | BBEDRGWUDRUNQC-UHFFFAOYSA-N |
| SMILES | NCCOC(c1ccc(F)cc1)c1ccc(F)cc1 |
| HS Code | 2922199090 |
|---|
|
~%
Flunamine CAS#:50366-32-0 |
| Literature: Gist-Brocades N.V. Patent: US4003932 A1, 1977 ; |
|
~%
Flunamine CAS#:50366-32-0 |
| Literature: Caldirola, PM; Goot, H van der; Timmerman, H European Journal of Medicinal Chemistry, 1992 , vol. 27, # 6 p. 571 - 579 |
|
~%
Flunamine CAS#:50366-32-0 |
| Literature: Caldirola, PM; Goot, H van der; Timmerman, H European Journal of Medicinal Chemistry, 1992 , vol. 27, # 6 p. 571 - 579 |
![1-[2-chloroethoxy-(4-fluorophenyl)methyl]-4-fluorobenzene structure](https://image.chemsrc.com/caspic/391/50366-31-9.png)
![2-[2-[bis(4-fluorophenyl)methoxy]ethyl]isoindole-1,3-dione structure](https://image.chemsrc.com/caspic/460/50499-52-0.png)
![1-[2-bromoethoxy-(4-fluorophenyl)methyl]-4-fluorobenzene structure](https://image.chemsrc.com/caspic/461/53915-75-6.png)
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Flunamine |
| 2-[Bis-(4-fluorphenyl)-methyloxy]ethylamin |
| Flunamine [INN] |
| 2-[bis(p-fluorophenyl)-methoxy]ethylamine |