2-bromo-2-(4-nitrophenyl)-1-phenyl-ethanone structure
|
Common Name | 2-bromo-2-(4-nitrophenyl)-1-phenyl-ethanone | ||
|---|---|---|---|---|
| CAS Number | 5033-71-6 | Molecular Weight | 320.13800 | |
| Density | 1.543g/cm3 | Boiling Point | 429.4ºC at 760 mmHg | |
| Molecular Formula | C14H10BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.5ºC | |
| Name | 2-bromo-2-(4-nitrophenyl)-1-phenylethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.543g/cm3 |
|---|---|
| Boiling Point | 429.4ºC at 760 mmHg |
| Molecular Formula | C14H10BrNO3 |
| Molecular Weight | 320.13800 |
| Flash Point | 213.5ºC |
| Exact Mass | 318.98400 |
| PSA | 62.89000 |
| LogP | 4.43690 |
| Index of Refraction | 1.643 |
| InChIKey | XLTBYLVUSIGVTA-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)C(Br)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2914700090 |
|---|
|
~%
2-bromo-2-(4-ni... CAS#:5033-71-6 |
| Literature: Cooper,D.J.; Owen,L.N. Journal of the Chemical Society [Section] C: Organic, 1966 , p. 533 - 540 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2-bromo-2-(4-nitrophenyl)-1-phenyl-ethanone |