5,5-dinitrooxan-2-one
Modify Date: 2024-09-14 17:16:00
5,5-dinitrooxan-2-one structure
|
Common Name | 5,5-dinitrooxan-2-one | ||
|---|---|---|---|---|
| CAS Number | 5029-19-6 | Molecular Weight | 190.11100 | |
| Density | 1.56g/cm3 | Boiling Point | 466.4ºC at 760 mmHg | |
| Molecular Formula | C5H6N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.1ºC | |
| Name | 3-Hexen-2-one,5,5-dinitro |
|---|---|
| Synonym | More Synonyms |
| Density | 1.56g/cm3 |
|---|---|
| Boiling Point | 466.4ºC at 760 mmHg |
| Molecular Formula | C5H6N2O6 |
| Molecular Weight | 190.11100 |
| Flash Point | 263.1ºC |
| Exact Mass | 190.02300 |
| PSA | 117.94000 |
| LogP | 0.61950 |
| Index of Refraction | 1.521 |
| InChIKey | IAUDMXHCCBDLHA-UHFFFAOYSA-N |
| SMILES | O=C1CCC([N+](=O)[O-])([N+](=O)[O-])CO1 |
|
~%
5,5-dinitrooxan... CAS#:5029-19-6 |
| Literature: Klager Journal of Organic Chemistry, 1951 , vol. 16, p. 161 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5,5-dinitro-hex-3-en-2-one |
| 5,5-dinitro-tetrahydro-pyran-2-one |