Carbonic acid, 4-formylphenyl pentyl ester
Modify Date: 2025-10-13 22:07:12
Carbonic acid, 4-formylphenyl pentyl ester structure
|
Common Name | Carbonic acid, 4-formylphenyl pentyl ester | ||
|---|---|---|---|---|
| CAS Number | 50262-57-2 | Molecular Weight | 236.26400 | |
| Density | 1.119g/cm3 | Boiling Point | 355.5ºC at 760 mmHg | |
| Molecular Formula | C13H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 156.3ºC | |
| Name | (4-formylphenyl) pentyl carbonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.119g/cm3 |
|---|---|
| Boiling Point | 355.5ºC at 760 mmHg |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.26400 |
| Flash Point | 156.3ºC |
| Exact Mass | 236.10500 |
| PSA | 52.60000 |
| LogP | 3.20470 |
| Index of Refraction | 1.524 |
| InChIKey | KOACVIOKTRPNAA-UHFFFAOYSA-N |
| SMILES | CCCCCOC(=O)Oc1ccc(C=O)cc1 |
| HS Code | 2920909090 |
|---|
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Carbonic acid,4-formylphenyl pentyl ester |