1,3-bis[(3,4-dimethoxyphenyl)methyl]-2-hexyl-1,3-diazinane structure
|
Common Name | 1,3-bis[(3,4-dimethoxyphenyl)methyl]-2-hexyl-1,3-diazinane | ||
|---|---|---|---|---|
| CAS Number | 5022-80-0 | Molecular Weight | 470.64400 | |
| Density | 1.058g/cm3 | Boiling Point | 547.9ºC at 760 mmHg | |
| Molecular Formula | C28H42N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 138.4ºC | |
| Name | 1,3-bis[(3,4-dimethoxyphenyl)methyl]-2-hexyl-1,3-diazinane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.058g/cm3 |
|---|---|
| Boiling Point | 547.9ºC at 760 mmHg |
| Molecular Formula | C28H42N2O4 |
| Molecular Weight | 470.64400 |
| Flash Point | 138.4ºC |
| Exact Mass | 470.31400 |
| PSA | 43.40000 |
| LogP | 5.60120 |
| Index of Refraction | 1.535 |
| InChIKey | PKHKLPGASDLLCF-UHFFFAOYSA-N |
| SMILES | CCCCCCC1N(Cc2ccc(OC)c(OC)c2)CCCN1Cc1ccc(OC)c(OC)c1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,3-bis(3,4-dimethoxybenzyl)-2-hexylhexahydropyrimidine |