Gorlic acid
Modify Date: 2025-09-26 08:16:53
Gorlic acid structure
|
Common Name | Gorlic acid | ||
|---|---|---|---|---|
| CAS Number | 502-31-8 | Molecular Weight | 278.43000 | |
| Density | 0.962g/cm3 | Boiling Point | 408.8ºC at 760 mmHg | |
| Molecular Formula | C18H30O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 305.5ºC | |
| Name | Gorlic acid |
|---|
| Density | 0.962g/cm3 |
|---|---|
| Boiling Point | 408.8ºC at 760 mmHg |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.43000 |
| Flash Point | 305.5ºC |
| Exact Mass | 278.22500 |
| PSA | 37.30000 |
| LogP | 5.49440 |
| Index of Refraction | 1.496 |
| InChIKey | XADKGDBMULSEAC-DUXPYHPUSA-N |
| SMILES | O=C(O)CCCCC=CCCCCCCC1C=CCC1 |
| HS Code | 2916209090 |
|---|
| HS Code | 2916209090 |
|---|---|
| Summary | 2916209090 other cyclanic, cyclenic or cyclotherpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |