2-amino-4-chloro-N-hydroxy-5-methyl-benzenesulfonamide structure
|
Common Name | 2-amino-4-chloro-N-hydroxy-5-methyl-benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 5016-11-5 | Molecular Weight | 236.67600 | |
| Density | 1.561g/cm3 | Boiling Point | 461.9ºC at 760 mmHg | |
| Molecular Formula | C7H9ClN2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.2ºC | |
| Name | 2-amino-4-chloro-N-hydroxy-5-methylbenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.561g/cm3 |
|---|---|
| Boiling Point | 461.9ºC at 760 mmHg |
| Molecular Formula | C7H9ClN2O3S |
| Molecular Weight | 236.67600 |
| Flash Point | 233.2ºC |
| Exact Mass | 236.00200 |
| PSA | 100.80000 |
| LogP | 2.95100 |
| Index of Refraction | 1.628 |
| InChIKey | JTPVHTRVUXTWTH-UHFFFAOYSA-N |
| SMILES | Cc1cc(S(=O)(=O)NO)c(N)cc1Cl |
| HS Code | 2935009090 |
|---|
|
~%
2-amino-4-chlor... CAS#:5016-11-5 |
| Literature: Wei,P.H.L. et al. Journal of Heterocyclic Chemistry, 1966 , vol. 3, # 1 p. 1 - 4 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| 2-amino-4-chloro-N-hydroxy-5-methyl-benzenesulfonamide |
| 4-Chlor-6-amino-N-hydroxy-m-toluolsulfonsaeureamid |