methyl 5-chloro-2-[2-(diethylamino)ethoxy]benzoate structure
|
Common Name | methyl 5-chloro-2-[2-(diethylamino)ethoxy]benzoate | ||
|---|---|---|---|---|
| CAS Number | 5014-26-6 | Molecular Weight | 285.76700 | |
| Density | 1.129g/cm3 | Boiling Point | 378.2ºC at 760 mmHg | |
| Molecular Formula | C14H20ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.6ºC | |
| Name | methyl 5-chloro-2-[2-(diethylamino)ethoxy]benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.129g/cm3 |
|---|---|
| Boiling Point | 378.2ºC at 760 mmHg |
| Molecular Formula | C14H20ClNO3 |
| Molecular Weight | 285.76700 |
| Flash Point | 182.6ºC |
| Exact Mass | 285.11300 |
| PSA | 38.77000 |
| LogP | 2.84720 |
| Index of Refraction | 1.516 |
| InChIKey | NEJQTHUQLBEWPQ-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCOc1ccc(Cl)cc1C(=O)OC |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Sch 1300 |