N-(4-tert-butylcyclohexyl)-2-chloroacetamide structure
|
Common Name | N-(4-tert-butylcyclohexyl)-2-chloroacetamide | ||
|---|---|---|---|---|
| CAS Number | 500887-21-8 | Molecular Weight | 231.76200 | |
| Density | 1.02g/cm3 | Boiling Point | 355.8ºC at 760 mmHg | |
| Molecular Formula | C12H22ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169ºC | |
| Name | N-(4-tert-butylcyclohexyl)-2-chloroacetamide |
|---|
| Density | 1.02g/cm3 |
|---|---|
| Boiling Point | 355.8ºC at 760 mmHg |
| Molecular Formula | C12H22ClNO |
| Molecular Weight | 231.76200 |
| Flash Point | 169ºC |
| Exact Mass | 231.13900 |
| PSA | 29.10000 |
| LogP | 3.33720 |
| Index of Refraction | 1.479 |
| InChIKey | LARCNSYEWOQQCU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CCC(NC(=O)CCl)CC1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |