2'-Fluoro-α-methyl-4-biphenylacetic acid
Modify Date: 2025-10-25 08:03:28
2'-Fluoro-α-methyl-4-biphenylacetic acid structure
|
Common Name | 2'-Fluoro-α-methyl-4-biphenylacetic acid | ||
|---|---|---|---|---|
| CAS Number | 5005-84-5 | Molecular Weight | 244.26100 | |
| Density | 1.199g/cm3 | Boiling Point | 381.3ºC at 760 mmHg | |
| Molecular Formula | C15H13FO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.4ºC | |
| Name | 2-[4-(2-fluorophenyl)phenyl]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.199g/cm3 |
|---|---|
| Boiling Point | 381.3ºC at 760 mmHg |
| Molecular Formula | C15H13FO2 |
| Molecular Weight | 244.26100 |
| Flash Point | 184.4ºC |
| Exact Mass | 244.09000 |
| PSA | 37.30000 |
| LogP | 3.68080 |
| Index of Refraction | 1.567 |
| InChIKey | MSUHIIYPJIGYBH-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)c1ccc(-c2ccccc2F)cc1 |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| afv 5 |