(S)-Boc-3-Methoxy-β-Phe-OH structure
|
Common Name | (S)-Boc-3-Methoxy-β-Phe-OH | ||
|---|---|---|---|---|
| CAS Number | 499995-77-6 | Molecular Weight | 295.331 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 458.5±45.0 °C at 760 mmHg | |
| Molecular Formula | C15H21NO5 | Melting Point | 81-83°C | |
| MSDS | USA | Flash Point | 231.1±28.7 °C | |
| Name | (3S)-3-(3-methoxyphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 458.5±45.0 °C at 760 mmHg |
| Melting Point | 81-83°C |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.331 |
| Flash Point | 231.1±28.7 °C |
| Exact Mass | 295.141968 |
| PSA | 84.86000 |
| LogP | 2.63 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.522 |
| InChIKey | DNXONWHJJNOKEU-LBPRGKRZSA-N |
| SMILES | COc1cccc(C(CC(=O)O)NC(=O)OC(C)(C)C)c1 |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzenepropanoic acid, β-[[(1,1-dimethylethoxy)carbonyl]amino]-3-methoxy-, (βS)- |
| 3-(3-Methoxyphenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid |
| Boc-3-Methoxy-L-b-phenylalanine |
| (3S)-3-(3-Methoxyphenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid |
| 3-[(tert-Butoxycarbonyl)amino]-3-(3-methoxyphenyl)propanoic acid |
| Benzenepropanoic acid, β-[[(1,1-dimethylethoxy)carbonyl]amino]-3-methoxy- |
| Boc-β-Phe(3-OMe)-OH |
| Boc-(S)-3-Amino-3-(3-methoxyphenyl)-propionic acid |
| N-Boc-L-3-Amino-3-(3-methoxylphenyl)propanoic acid |
| (S)-Boc-3-Methoxy-β-Phe-OH |