(R)-3-amino-3-(4-bromophenyl)propanoic acid hydrochloride structure
|
Common Name | (R)-3-amino-3-(4-bromophenyl)propanoic acid hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 499794-78-4 | Molecular Weight | 280.54600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11BrClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3R)-3-Amino-3-(4-bromophenyl)propanoic acid hydrochloride (1:1) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H11BrClNO2 |
|---|---|
| Molecular Weight | 280.54600 |
| Exact Mass | 278.96600 |
| PSA | 63.32000 |
| LogP | 3.42590 |
| InChIKey | UDMBAXSJPLSJGM-DDWIOCJRSA-N |
| SMILES | Cl.NC(CC(=O)O)c1ccc(Br)cc1 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| MFCD03427884 |