Ethyl (2-amino-4-hydroxy-6-methyl-5-pyrimidinyl)acetate structure
|
Common Name | Ethyl (2-amino-4-hydroxy-6-methyl-5-pyrimidinyl)acetate | ||
|---|---|---|---|---|
| CAS Number | 499209-19-7 | Molecular Weight | 211.21800 | |
| Density | 1.36g/cm3 | Boiling Point | 349.5ºC at 760mmHg | |
| Molecular Formula | C9H13N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.2ºC | |
| Name | ethyl 2-(2-amino-6-methyl-4-oxo-1H-pyrimidin-5-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 349.5ºC at 760mmHg |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.21800 |
| Flash Point | 165.2ºC |
| Exact Mass | 211.09600 |
| PSA | 98.33000 |
| LogP | 0.75960 |
| Index of Refraction | 1.591 |
| InChIKey | QQVHAVBZUUKKSU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cc1c(C)nc(N)[nH]c1=O |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Ethyl (2-amino-4-hydroxy-6-methyl-5-pyrimidinyl)acetate |