methyl N-[6-(methoxycarbonyl-nitroso-amino)hexyl]-N-nitroso-carbamate structure
|
Common Name | methyl N-[6-(methoxycarbonyl-nitroso-amino)hexyl]-N-nitroso-carbamate | ||
|---|---|---|---|---|
| CAS Number | 4991-18-8 | Molecular Weight | 290.27300 | |
| Density | 1.28g/cm3 | Boiling Point | 365.1ºC at 760 mmHg | |
| Molecular Formula | C10H18N4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.6ºC | |
| Name | methyl N-[6-[methoxycarbonyl(nitroso)amino]hexyl]-N-nitrosocarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 365.1ºC at 760 mmHg |
| Molecular Formula | C10H18N4O6 |
| Molecular Weight | 290.27300 |
| Flash Point | 174.6ºC |
| Exact Mass | 290.12300 |
| PSA | 117.94000 |
| LogP | 2.04640 |
| Index of Refraction | 1.52 |
| InChIKey | RJLHNLDWJWZWNF-UHFFFAOYSA-N |
| SMILES | COC(=O)N(CCCCCCN(N=O)C(=O)OC)N=O |
|
~%
methyl N-[6-(me... CAS#:4991-18-8 |
| Literature: Samour; Mason Journal of the American Chemical Society, 1954 , vol. 76, p. 441,443 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| N,N'-dinitroso-N,N'-hexanediyl-bis-carbamic acid dimethyl ester |
| N,N'-Dinitroso-N,N'-hexandiyl-bis-carbamidsaeure-dimethylester |