triethyl(4-trimethylstannylpent-4-en-1-ynyl)silane structure
|
Common Name | triethyl(4-trimethylstannylpent-4-en-1-ynyl)silane | ||
|---|---|---|---|---|
| CAS Number | 498547-49-2 | Molecular Weight | 343.15900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H28SiSn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | triethyl(4-trimethylstannylpent-4-en-1-ynyl)silane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H28SiSn |
|---|---|
| Molecular Weight | 343.15900 |
| Exact Mass | 344.09800 |
| LogP | 4.38690 |
| InChIKey | RTPGDQCNMFNZOQ-UHFFFAOYSA-N |
| SMILES | C=C(CC#C[Si](CC)(CC)CC)[Sn](C)(C)C |
|
~88%
triethyl(4-trim... CAS#:498547-49-2 |
| Literature: Shirakawa, Eiji; Hiyama, Tamejiro Bulletin of the Chemical Society of Japan, 2002 , vol. 75, # 7 p. 1435 - 1450 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 5-triethylsilyl-2-trimethylstannyl-1-penten-4-yne |
| 5-triethylsilyl-2-trimethylstannylpent-1-en-4-yne |