3-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-2-hydroxy-6-methyl-pyran-4-one structure
|
Common Name | 3-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-2-hydroxy-6-methyl-pyran-4-one | ||
|---|---|---|---|---|
| CAS Number | 49821-34-3 | Molecular Weight | 316.30500 | |
| Density | 1.319g/cm3 | Boiling Point | 509.8ºC at 760 mmHg | |
| Molecular Formula | C17H16O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.9ºC | |
| Name | (3Z)-3-[(E)-3-(3,4-dimethoxyphenyl)-1-hydroxyprop-2-enylidene]-6-methylpyran-2,4-dione |
|---|
| Density | 1.319g/cm3 |
|---|---|
| Boiling Point | 509.8ºC at 760 mmHg |
| Molecular Formula | C17H16O6 |
| Molecular Weight | 316.30500 |
| Flash Point | 186.9ºC |
| Exact Mass | 316.09500 |
| PSA | 85.97000 |
| LogP | 2.56710 |
| Index of Refraction | 1.615 |
| InChIKey | GDVXNIUZGNCPOX-GQCTYLIASA-N |
| SMILES | COc1ccc(C=CC(=O)c2c(O)cc(C)oc2=O)cc1OC |
|
~63%
3-[(E)-3-(3,4-d... CAS#:49821-34-3 |
| Literature: Muthukumar; Viswanathamurthi Journal of Coordination Chemistry, 2010 , vol. 63, # 7 p. 1263 - 1272 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |