2,6-ditert-butyl-4-propylphenol
Modify Date: 2025-08-25 19:24:26
2,6-ditert-butyl-4-propylphenol structure
|
Common Name | 2,6-ditert-butyl-4-propylphenol | ||
|---|---|---|---|---|
| CAS Number | 4973-24-4 | Molecular Weight | 248.40400 | |
| Density | 0.918g/cm3 | Boiling Point | 293.8ºC at 760 mmHg | |
| Molecular Formula | C17H28O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 132.2ºC | |
| Name | 2,6-ditert-butyl-4-propylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.918g/cm3 |
|---|---|
| Boiling Point | 293.8ºC at 760 mmHg |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.40400 |
| Flash Point | 132.2ºC |
| Exact Mass | 248.21400 |
| PSA | 20.23000 |
| LogP | 4.93970 |
| Index of Refraction | 1.496 |
| InChIKey | STHGHFNAPPFPQV-UHFFFAOYSA-N |
| SMILES | CCCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
|
~72%
2,6-ditert-buty... CAS#:4973-24-4 |
| Literature: Baik, Woonphil; Lee, Hyun Joo; Koo, Sangho; Kim, Byeong Hyo Tetrahedron Letters, 1998 , vol. 39, # 44 p. 8125 - 8128 |
|
~%
2,6-ditert-buty... CAS#:4973-24-4 |
| Literature: Hey; Waters Journal of the Chemical Society, 1955 , p. 2753 |
| 2,6-di-tert-butyl-4-propyllphenol |
| Phenol,2,6-di-tert-butyl-4-propyl |
| 2,6-di-t-butyl-4-n-propyl phenol |
| 2,6-Di-tert-butyl-4-propylphenol |