(2R)-2-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid structure
|
Common Name | (2R)-2-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 496918-28-6 | Molecular Weight | 219.235 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 422.8±35.0 °C at 760 mmHg | |
| Molecular Formula | C9H17NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.5±25.9 °C | |
| Name | (2R)-2-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 422.8±35.0 °C at 760 mmHg |
| Molecular Formula | C9H17NO5 |
| Molecular Weight | 219.235 |
| Flash Point | 209.5±25.9 °C |
| Exact Mass | 219.110672 |
| PSA | 95.86000 |
| LogP | 0.73 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Index of Refraction | 1.485 |
| InChIKey | POASMXSJVKADPM-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC(=O)NCCC(O)C(=O)O |
| HS Code | 2924199090 |
|---|
|
~91%
(2R)-2-hydroxy-... CAS#:496918-28-6 |
| Literature: Farkas, Michelle E.; Li, Benjamin C.; Dose, Christian; Dervan, Peter B. Bioorganic and Medicinal Chemistry Letters, 2009 , vol. 19, # 14 p. 3919 - 3923 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-tert-Butoxycarbonylamino-2-hydroxy-butyric acid |
| (2R)-2-Hydroxy-4-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butanoic acid |
| (2R)-4-[(tert-Butoxycarbonyl)amino]-2-hydroxybutanoic acid |
| Butanoic acid, 4-[[(1,1-dimethylethoxy)carbonyl]amino]-2-hydroxy-, (2R)- |