OH-C-Chol structure
|
Common Name | OH-C-Chol | ||
|---|---|---|---|---|
| CAS Number | 496801-51-5 | Molecular Weight | 516.799 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 631.4±48.0 °C at 760 mmHg | |
| Molecular Formula | C32H56N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 335.7±29.6 °C | |
Use of OH-C-CholOH-C-Chol is a cationic cholesterol derivative. |
| Name | OH-C-Chol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 631.4±48.0 °C at 760 mmHg |
| Molecular Formula | C32H56N2O3 |
| Molecular Weight | 516.799 |
| Flash Point | 335.7±29.6 °C |
| Exact Mass | 516.429077 |
| LogP | 9.60 |
| Vapour Pressure | 0.0±4.2 mmHg at 25°C |
| Index of Refraction | 1.534 |
| InChIKey | IVKGTZVIOSLOAM-PTHRTHQKSA-N |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4CC(OC(=O)NCCNCCO)CCC4(C)C3CCC12C |
| Carbamic acid, N-[2-[(2-hydroxyethyl)amino]ethyl]-, (3β)-cholest-5-en-3-yl ester |
| (3β)-Cholest-5-en-3-yl {2-[(2-hydroxyethyl)amino]ethyl}carbamate |
| OH-C-Chol |